EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:70796 - 1-deoxy-11β-hydroxypentalenic acid
| Formula | C15H22O3 |
| Net Charge | 0 |
| Average Mass | 250.338 |
| Monoisotopic Mass | 250.15689 |
| SMILES | [H][C@@]12C[C@@H](O)[C@@H](C)[C@@]13CC(C)(C)C[C@@]3([H])C=C2C(=O)O |
| InChI | InChI=1S/C15H22O3/c1-8-12(16)5-11-10(13(17)18)4-9-6-14(2,3)7-15(8,9)11/h4,8-9,11-12,16H,5-7H2,1-3H3,(H,17,18)/t8-,9-,11+,12-,15-/m1/s1 |
| InChIKey | IZHNAGBQRXWHMT-QLLAZOAUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-deoxy-11β-hydroxypentalenic acid (CHEBI:70796) has functional parent pentalenene (CHEBI:17251) |
| 1-deoxy-11β-hydroxypentalenic acid (CHEBI:70796) has role metabolite (CHEBI:25212) |
| 1-deoxy-11β-hydroxypentalenic acid (CHEBI:70796) is a 5-hydroxy monocarboxylic acid (CHEBI:37125) |
| 1-deoxy-11β-hydroxypentalenic acid (CHEBI:70796) is a carbotricyclic compound (CHEBI:38032) |
| 1-deoxy-11β-hydroxypentalenic acid (CHEBI:70796) is a sesquiterpenoid (CHEBI:26658) |
| 1-deoxy-11β-hydroxypentalenic acid (CHEBI:70796) is conjugate acid of 1-deoxy-11β-hydroxypentalenate (CHEBI:70779) |
| Incoming Relation(s) |
| 1-deoxy-11β-hydroxypentalenate (CHEBI:70779) is conjugate base of 1-deoxy-11β-hydroxypentalenic acid (CHEBI:70796) |
| IUPAC Name |
|---|
| (1S,2R,3aR,5aS,8aR)-2-hydroxy-1,7,7-trimethyl-1,2,3,3a,5a,6,7,8-octahydrocyclopenta[c]pentalene-4-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-13620 | MetaCyc |
| Citations |
|---|