EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H46N2O3S |
| Net Charge | 0 |
| Average Mass | 502.765 |
| Monoisotopic Mass | 502.32291 |
| SMILES | CC(C)(Sc1ccc(CCN(CCCCC2CCCCC2)C(=O)NC2CCCCC2)cc1)C(=O)O |
| InChI | InChI=1S/C29H46N2O3S/c1-29(2,27(32)33)35-26-18-16-24(17-19-26)20-22-31(28(34)30-25-14-7-4-8-15-25)21-10-9-13-23-11-5-3-6-12-23/h16-19,23,25H,3-15,20-22H2,1-2H3,(H,30,34)(H,32,33) |
| InChIKey | PKNYXWMTHFMHKD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | PPARalpha agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-α. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GW 7647 (CHEBI:70778) has role PPARα agonist (CHEBI:70782) |
| GW 7647 (CHEBI:70778) is a aryl sulfide (CHEBI:35683) |
| GW 7647 (CHEBI:70778) is a monocarboxylic acid (CHEBI:25384) |
| GW 7647 (CHEBI:70778) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| 2-[(4-{2-[(4-cyclohexylbutyl)(cyclohexylcarbamoyl)amino]ethyl}phenyl)sulfanyl]-2-methylpropanoic acid |
| Synonyms | Source |
|---|---|
| GW-7647 | ChEBI |
| 2-({4-{2-{{(cyclohexylamino)carbonyl}(4-cyclohexylbutyl)amino}ethyl}phenyl}thio)-2-methylpropanoic acid | ChEBI |
| 2-((4-(2-(1-cyclohexylbutyl)-3-cyclohexylureido)ethyl)phenylthio)-2-methylpropionic acid | ChEBI |
| 2-(4-(2-(1-(4-cyclohexylbutyl)-3-cyclohexylureido)ethyl)phenylthio)-2-methylpropionic acid | ChEBI |
| 2-(4-(2-(1-(cyclohexanebutyl)-3-cyclohexylureido)ethyl)phenylthio)-2-methylpropionic acid | ChEBI |
| 2-[[4-[2-[[(cyclohexylamino)carbonyl](4-cyclohexylbutyl)amino]ethyl]phenyl]thio]-2-methylpropanoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8955332 | Reaxys |
| CAS:265129-71-3 | ChemIDplus |
| CAS:265129-71-3 | KEGG COMPOUND |
| Citations |
|---|