EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2O3 |
| Net Charge | 0 |
| Average Mass | 220.228 |
| Monoisotopic Mass | 220.08479 |
| SMILES | NC(Cc1cnc2c(O)cccc12)C(=O)O |
| InChI | InChI=1S/C11H12N2O3/c12-8(11(15)16)4-6-5-13-10-7(6)2-1-3-9(10)14/h1-3,5,8,13-14H,4,12H2,(H,15,16) |
| InChIKey | VQSRKJZICBNQJG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-hydroxytryptophan (CHEBI:70777) has role human urinary metabolite (CHEBI:84087) |
| 7-hydroxytryptophan (CHEBI:70777) is a hydroxytryptophan (CHEBI:84194) |
| Incoming Relation(s) |
| 7-hydroxy-L-tryptophan (CHEBI:49348) is a 7-hydroxytryptophan (CHEBI:70777) |
| IUPAC Names |
|---|
| 7-hydroxytryptophan |
| 2-amino-3-(7-hydroxy-1H-indol-3-yl)propanoic acid |
| Synonym | Source |
|---|---|
| 7-hydroxy-DL-tryptophan | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:17412 | Reaxys |
| Citations |
|---|