EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3 |
| Net Charge | 0 |
| Average Mass | 131.131 |
| Monoisotopic Mass | 131.05824 |
| SMILES | O=C(O)[C@@H]1NCC[C@H]1O |
| InChI | InChI=1S/C5H9NO3/c7-3-1-2-6-4(3)5(8)9/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4-/m1/s1 |
| InChIKey | BJBUEDPLEOHJGE-QWWZWVQMSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-3-hydroxy-D-proline (CHEBI:70756) has role metabolite (CHEBI:25212) |
| trans-3-hydroxy-D-proline (CHEBI:70756) is a 3-hydroxyproline (CHEBI:64368) |
| IUPAC Names |
|---|
| (2R,3R)-3-hydroxypyrrolidine-2-carboxylic acid |
| (3R)-3-hydroxy-D-proline |
| Registry Numbers | Sources |
|---|---|
| Reaxys:471960 | Reaxys |
| Citations |
|---|