EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24O6 |
| Net Charge | 0 |
| Average Mass | 312.362 |
| Monoisotopic Mass | 312.15729 |
| SMILES | [H][C@@]12CCCO[C@@]1([H])[C@H](O)[C@@]1([H])O[C@@]([H])(/C=C/[C@H](O)CO)C=CC[C@]1([H])O2 |
| InChI | InChI=1S/C16H24O6/c17-9-10(18)6-7-11-3-1-4-13-16(21-11)14(19)15-12(22-13)5-2-8-20-15/h1,3,6-7,10-19H,2,4-5,8-9H2/b7-6+/t10-,11+,12+,13-,14-,15+,16-/m0/s1 |
| InChIKey | UQBKARYLDQRSJF-MHXRFSLHSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ciguatoxin ABC ring fragment (CHEBI:70750) has role epitope (CHEBI:53000) |
| ciguatoxin ABC ring fragment (CHEBI:70750) is a organic heterotricyclic compound (CHEBI:26979) |
| ciguatoxin ABC ring fragment (CHEBI:70750) is a polycyclic ether (CHEBI:36468) |
| IUPAC Name |
|---|
| (2S,3E)-4-[(4aR,5aS,9R,10aR,11S,11aS)-11-hydroxy-2,3,4,4a,5a,6,9,10a,11,11a-decahydropyrano[2',3':5,6]pyrano[3,2-b]oxepin-9-yl]but-3-ene-1,2-diol |
| Citations |
|---|