EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H32N4O3S |
| Net Charge | 0 |
| Average Mass | 516.667 |
| Monoisotopic Mass | 516.21951 |
| SMILES | CCS(=O)(=O)Nc1ccc2c(c1)/C(=C(/Nc1ccc(CN3CCCCC3)cc1)c1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C29H32N4O3S/c1-2-37(35,36)32-24-15-16-26-25(19-24)27(29(34)31-26)28(22-9-5-3-6-10-22)30-23-13-11-21(12-14-23)20-33-17-7-4-8-18-33/h3,5-6,9-16,19,30,32H,2,4,7-8,17-18,20H2,1H3,(H,31,34)/b28-27- |
| InChIKey | GLDSKRNGVVYJAB-DQSJHHFOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Aurora kinase inhibitor Any protein kinase inhibitor that inhibits the action of an Aurora kinase (a group of serine/threonine kinases that are essential for cell proliferation). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hesperadin (CHEBI:70726) has role Aurora kinase inhibitor (CHEBI:70770) |
| hesperadin (CHEBI:70726) is a enamine (CHEBI:47989) |
| hesperadin (CHEBI:70726) is a oxindoles (CHEBI:38459) |
| hesperadin (CHEBI:70726) is a piperidines (CHEBI:26151) |
| hesperadin (CHEBI:70726) is a sulfonamide (CHEBI:35358) |
| hesperadin (CHEBI:70726) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-[(3Z)-2-oxo-3-(phenyl{[4-(piperidin-1-ylmethyl)phenyl]amino}methylidene)-2,3-dihydro-1H-indol-5-yl]ethanesulfonamide |
| Synonym | Source |
|---|---|
| hesperadine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Hesperadin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14118003 | Reaxys |
| CAS:422513-13-1 | Wikipedia |
| Citations |
|---|