EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27N7O |
| Net Charge | 0 |
| Average Mass | 393.495 |
| Monoisotopic Mass | 393.22771 |
| SMILES | c1nc2nc(Nc3ccc(N4CCOCC4)cc3)nc(NC3CCCCC3)c2n1 |
| InChI | InChI=1S/C21H27N7O/c1-2-4-15(5-3-1)24-20-18-19(23-14-22-18)26-21(27-20)25-16-6-8-17(9-7-16)28-10-12-29-13-11-28/h6-9,14-15H,1-5,10-13H2,(H3,22,23,24,25,26,27) |
| InChIKey | ZFLJHSQHILSNCM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | cell dedifferentiation agent Any compound which induces a partially or terminally differentiated cell to revert to an earlier developmental stage. adenosine A3 receptor antagonist An antagonist at the A3 receptor. Aurora kinase inhibitor Any protein kinase inhibitor that inhibits the action of an Aurora kinase (a group of serine/threonine kinases that are essential for cell proliferation). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| reversine (CHEBI:70723) has functional parent 9H-purine-2,6-diamine (CHEBI:40235) |
| reversine (CHEBI:70723) has role adenosine A3 receptor antagonist (CHEBI:70725) |
| reversine (CHEBI:70723) has role antineoplastic agent (CHEBI:35610) |
| reversine (CHEBI:70723) has role Aurora kinase inhibitor (CHEBI:70770) |
| reversine (CHEBI:70723) has role cell dedifferentiation agent (CHEBI:70724) |
| reversine (CHEBI:70723) is a morpholines (CHEBI:38785) |
| reversine (CHEBI:70723) is a purines (CHEBI:26401) |
| reversine (CHEBI:70723) is a secondary amino compound (CHEBI:50995) |
| reversine (CHEBI:70723) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N6-cyclohexyl-N2-[4-(morpholin-4-yl)phenyl]-9H-purine-2,6-diamine |
| Synonym | Source |
|---|---|
| 2-(4-morpholinoanilino)-6-cyclohexylaminopurine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9591952 | Reaxys |
| CAS:656820-32-5 | ChemIDplus |
| Citations |
|---|