EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27N7O |
| Net Charge | 0 |
| Average Mass | 393.495 |
| Monoisotopic Mass | 393.22771 |
| SMILES | c1nc2nc(Nc3ccc(N4CCOCC4)cc3)nc(NC3CCCCC3)c2n1 |
| InChI | InChI=1S/C21H27N7O/c1-2-4-15(5-3-1)24-20-18-19(23-14-22-18)26-21(27-20)25-16-6-8-17(9-7-16)28-10-12-29-13-11-28/h6-9,14-15H,1-5,10-13H2,(H3,22,23,24,25,26,27) |
| InChIKey | ZFLJHSQHILSNCM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Aurora kinase inhibitor Any protein kinase inhibitor that inhibits the action of an Aurora kinase (a group of serine/threonine kinases that are essential for cell proliferation). cell dedifferentiation agent Any compound which induces a partially or terminally differentiated cell to revert to an earlier developmental stage. adenosine A3 receptor antagonist An antagonist at the A3 receptor. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| reversine (CHEBI:70723) has functional parent 9H-purine-2,6-diamine (CHEBI:40235) |
| reversine (CHEBI:70723) has role adenosine A3 receptor antagonist (CHEBI:70725) |
| reversine (CHEBI:70723) has role antineoplastic agent (CHEBI:35610) |
| reversine (CHEBI:70723) has role Aurora kinase inhibitor (CHEBI:70770) |
| reversine (CHEBI:70723) has role cell dedifferentiation agent (CHEBI:70724) |
| reversine (CHEBI:70723) is a morpholines (CHEBI:38785) |
| reversine (CHEBI:70723) is a purines (CHEBI:26401) |
| reversine (CHEBI:70723) is a secondary amino compound (CHEBI:50995) |
| reversine (CHEBI:70723) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N6-cyclohexyl-N2-[4-(morpholin-4-yl)phenyl]-9H-purine-2,6-diamine |
| Synonym | Source |
|---|---|
| 2-(4-morpholinoanilino)-6-cyclohexylaminopurine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9591952 | Reaxys |
| CAS:656820-32-5 | ChemIDplus |
| Citations |
|---|