EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H21N8O8PS4.C2H4O2.H2O |
| Net Charge | 0 |
| Average Mass | 762.767 |
| Monoisotopic Mass | 762.04197 |
| SMILES | CC(=O)O.O.[H][C@]12SCC(Sc3nc(-c4cc[n+](C)cc4)cs3)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)/C(=N\OCC)c1nsc(NP(=O)(O)O)n1 |
| InChI | InChI=1S/C22H21N8O8PS4.C2H4O2.H2O/c1-3-38-26-13(16-25-21(43-28-16)27-39(35,36)37)17(31)24-14-18(32)30-15(20(33)34)12(9-40-19(14)30)42-22-23-11(8-41-22)10-4-6-29(2)7-5-10;1-2(3)4;/h4-8,14,19H,3,9H2,1-2H3,(H4-,24,25,27,28,31,33,34,35,36,37);1H3,(H,3,4);1H2/b26-13-;;/t14-,19-;;/m1../s1 |
| InChIKey | KRWPPVCZNGQQHZ-IINIBMQSSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial drug A drug used to treat or prevent bacterial infections. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceftaroline fosamil acetate monohydrate (CHEBI:70714) has part ceftaroline fosamil acetate (CHEBI:70715) |
| ceftaroline fosamil acetate monohydrate (CHEBI:70714) has role antibacterial drug (CHEBI:36047) |
| ceftaroline fosamil acetate monohydrate (CHEBI:70714) has role antimicrobial agent (CHEBI:33281) |
| ceftaroline fosamil acetate monohydrate (CHEBI:70714) has role prodrug (CHEBI:50266) |
| ceftaroline fosamil acetate monohydrate (CHEBI:70714) is a hydrate (CHEBI:35505) |
| IUPAC Name |
|---|
| (6R,7R)-7-({(2Z)-2-(ethoxyimino)-2-[5-(phosphonoamino)-1,2,4-thiadiazol-3-yl]acetyl}amino)-3-{[4-(1-methylpyridinium-4-yl)-1,3-thiazol-2-yl]sulfanyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate acetate—water (1/1) |
| INN | Source |
|---|---|
| ceftaroline fosamil | KEGG DRUG |
| Synonym | Source |
|---|---|
| Ceftaroline fosamil acetate hydrate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Teflaro | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D08884 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:400827-55-6 | ChemIDplus |
| CAS:866021-48-9 | ChemIDplus |
| CAS:866021-48-9 | KEGG DRUG |
| Citations |
|---|