EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H59NO11.CH4O3S |
| Net Charge | 0 |
| Average Mass | 826.015 |
| Monoisotopic Mass | 825.39693 |
| SMILES | CS(=O)(=O)O.[H][C@@]12CC[C@]3([H])O[C@@]4([H])[C@H]5O[C@]6(CC[C@@]7([H])CC(=C)[C@]([H])(CC[C@@]8([H])C[C@@H](C)C(=C)[C@@]([H])(C[C@]9([H])O[C@H](C[C@H](O)CN)[C@H](OC)[C@@]9([H])CC(=O)C1)O8)O7)C[C@@]5([H])O[C@@]4([H])[C@@]([H])(O6)[C@@]3([H])O2 |
| InChI | InChI=1S/C40H59NO11.CH4O3S/c1-19-11-24-5-7-28-20(2)12-26(45-28)9-10-40-17-33-36(51-40)37-38(50-33)39(52-40)35-29(49-37)8-6-25(47-35)13-22(42)14-27-31(16-30(46-24)21(19)3)48-32(34(27)44-4)15-23(43)18-41;1-5(2,3)4/h19,23-39,43H,2-3,5-18,41H2,1,4H3;1H3,(H,2,3,4)/t19-,23+,24+,25-,26+,27+,28+,29+,30-,31+,32-,33-,34-,35+,36+,37+,38-,39+,40+;/m1./s1 |
| InChIKey | QAMYWGZHLCQOOJ-WRNBYXCMSA-N |
| Roles Classification |
|---|
| Biological Role: | microtubule-destabilising agent Any substance that interacts with tubulin to inhibit polymerisation of microtubules. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eribulin mesylate (CHEBI:70710) has part eribulin(1+) (CHEBI:70711) |
| eribulin mesylate (CHEBI:70710) has role antineoplastic agent (CHEBI:35610) |
| eribulin mesylate (CHEBI:70710) has role microtubule-destabilising agent (CHEBI:61951) |
| eribulin mesylate (CHEBI:70710) is a methanesulfonate salt (CHEBI:38037) |
| IUPAC Name |
|---|
| 2-(3-amino-2-hydroxypropyl)hexacosahydro-3-methoxy-26-methyl-20,27-bis(methylene)11,15-18,21-24,28-triepoxy-7,9-ethano-12,15-methano-9H,15H-furo(3,2-i)furo(2',3'-5,6)pyrano(4,3-b)(1,4)dioxacyclopentacosin-5-(4H)-one methanesulfonate |
| Synonyms | Source |
|---|---|
| Eribulin mesilate | KEGG DRUG |
| E7389 | ChemIDplus |
| E 7389 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Halaven | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D08914 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11271529 | Reaxys |
| CAS:441045-17-6 | KEGG DRUG |
| CAS:441045-17-6 | ChemIDplus |
| Citations |
|---|