EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25NO2 |
| Net Charge | 0 |
| Average Mass | 311.425 |
| Monoisotopic Mass | 311.18853 |
| SMILES | [H][C@@]12CC[C@@](O)(CC#N)[C@@]1(C)CCC1=C3CCC(=O)C=C3CC[C@]12[H] |
| InChI | InChI=1S/C20H25NO2/c1-19-8-6-16-15-5-3-14(22)12-13(15)2-4-17(16)18(19)7-9-20(19,23)10-11-21/h12,17-18,23H,2-10H2,1H3/t17-,18+,19+,20-/m1/s1 |
| InChIKey | AZFLJNIPTRTECV-FUMNGEBKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | progestin A synthetic progestogen. progesterone receptor agonist A hormone agonist that binds to and activates progesterone receptors. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | progesterone receptor agonist A hormone agonist that binds to and activates progesterone receptors. synthetic oral contraceptive An oral contraceptive which owes its effectiveness to synthetic preparation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dienogest (CHEBI:70708) has parent hydride estrane (CHEBI:23966) |
| dienogest (CHEBI:70708) has role progesterone receptor agonist (CHEBI:70709) |
| dienogest (CHEBI:70708) has role progestin (CHEBI:59826) |
| dienogest (CHEBI:70708) has role synthetic oral contraceptive (CHEBI:49326) |
| dienogest (CHEBI:70708) is a 17β-hydroxy steroid (CHEBI:35343) |
| dienogest (CHEBI:70708) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| dienogest (CHEBI:70708) is a aliphatic nitrile (CHEBI:80291) |
| dienogest (CHEBI:70708) is a steroid hormone (CHEBI:26764) |
| IUPAC Name |
|---|
| [(17β)-17-hydroxy-3-oxoestra-4,9-dien-17-yl]acetonitrile |
| INNs | Source |
|---|---|
| dienogest | KEGG DRUG |
| diénogest | WHO MedNet |
| dienogestum | WHO MedNet |
| dienogest | WHO MedNet |
| Synonyms | Source |
|---|---|
| 17alpha-Cyanomethyl-17beta-hydroxyestra-4,9(10)-dien-3-one | ChemIDplus |
| (17-hydroxy-3-oxoestra-4,9-dien-17β-yl)acetonitrile | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D03799 | KEGG DRUG |
| EP1935898 | Patent |
| US2010298585 | Patent |
| WO2011132045 | Patent |
| US2008214512 | Patent |
| US6670350 | Patent |
| WO2008116890 | Patent |
| Dienogest | Wikipedia |
| 871 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5763925 | Reaxys |
| CAS:65928-58-7 | KEGG DRUG |
| CAS:65928-58-7 | ChemIDplus |
| Citations |
|---|