EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H27N5O2 |
| Net Charge | 0 |
| Average Mass | 441.535 |
| Monoisotopic Mass | 441.21648 |
| SMILES | N#Cc1ccc2ncc(CCCCN3CCN(c4ccc5oc(C(N)=O)cc5c4)CC3)c2c1 |
| InChI | InChI=1S/C26H27N5O2/c27-16-18-4-6-23-22(13-18)19(17-29-23)3-1-2-8-30-9-11-31(12-10-30)21-5-7-24-20(14-21)15-25(33-24)26(28)32/h4-7,13-15,17,29H,1-3,8-12H2,(H2,28,32) |
| InChIKey | SGEGOXDYSFKCPT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vilazodone (CHEBI:70707) has role antidepressant (CHEBI:35469) |
| vilazodone (CHEBI:70707) has role anxiolytic drug (CHEBI:35474) |
| vilazodone (CHEBI:70707) has role serotonergic agonist (CHEBI:35941) |
| vilazodone (CHEBI:70707) has role serotonin uptake inhibitor (CHEBI:50949) |
| vilazodone (CHEBI:70707) is a N-alkylpiperazine (CHEBI:46845) |
| vilazodone (CHEBI:70707) is a N-arylpiperazine (CHEBI:46848) |
| vilazodone (CHEBI:70707) is a 1-benzofurans (CHEBI:38830) |
| vilazodone (CHEBI:70707) is a indoles (CHEBI:24828) |
| vilazodone (CHEBI:70707) is a monocarboxylic acid amide (CHEBI:29347) |
| vilazodone (CHEBI:70707) is a nitrile (CHEBI:18379) |
| vilazodone (CHEBI:70707) is conjugate base of vilazodone(1+) (CHEBI:70706) |
| Incoming Relation(s) |
| vilazodone(1+) (CHEBI:70706) is conjugate acid of vilazodone (CHEBI:70707) |
| IUPAC Name |
|---|
| 5-{4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl}-1-benzofuran-2-carboxamide |
| INNs | Source |
|---|---|
| vilazodona | WHO MedNet |
| vilazodone | KEGG DRUG |
| vilazodone | WHO MedNet |
| vilazodonum | WHO MedNet |
| Synonyms | Source |
|---|---|
| EMD 515259 | ChEMBL |
| EMD-515259 | ChEMBL |
| EMD-68-843 | ChEMBL |
| Emd-68843 base | ChEMBL |
| EMD 68843 BASE | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4223 | DrugCentral |
| D09698 | KEGG DRUG |
| DB06684 | DrugBank |
| HMDB0015637 | HMDB |
| US5532241 | Patent |
| US6531503 | Patent |
| Vilazodone | Wikipedia |
| WO2004113326 | Patent |
| WO2005018676 | Patent |
| WO2005023243 | Patent |
| WO2005056056 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9830698 | Reaxys |
| CAS:163521-12-8 | ChemIDplus |
| CAS:163521-12-8 | KEGG DRUG |
| Citations |
|---|