EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H27N5O2.HCl |
| Net Charge | 0 |
| Average Mass | 477.996 |
| Monoisotopic Mass | 477.19315 |
| SMILES | Cl.N#Cc1ccc2ncc(CCCCN3CCN(c4ccc5oc(C(N)=O)cc5c4)CC3)c2c1 |
| InChI | InChI=1S/C26H27N5O2.ClH/c27-16-18-4-6-23-22(13-18)19(17-29-23)3-1-2-8-30-9-11-31(12-10-30)21-5-7-24-20(14-21)15-25(33-24)26(28)32;/h4-7,13-15,17,29H,1-3,8-12H2,(H2,28,32);1H |
| InChIKey | RPZBRGFNBNQSOP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| Applications: | serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vilazodone hydrochloride (CHEBI:70705) has part vilazodone(1+) (CHEBI:70706) |
| vilazodone hydrochloride (CHEBI:70705) has role antidepressant (CHEBI:35469) |
| vilazodone hydrochloride (CHEBI:70705) has role serotonergic agonist (CHEBI:35941) |
| vilazodone hydrochloride (CHEBI:70705) has role serotonin uptake inhibitor (CHEBI:50949) |
| vilazodone hydrochloride (CHEBI:70705) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 5-{4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl}-1-benzofuran-2-carboxamide hydrochloride |
| Synonyms | Source |
|---|---|
| 4-(2-carbamoyl-1-benzofuran-5-yl)-1-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-ium chloride | IUPAC |
| EMD 68 843 | ChemIDplus |
| Vilazodone HCl | ChemIDplus |
| vilazodone monohydrochloride | ChEBI |
| Brand Name | Source |
|---|---|
| Viibryd | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9830698 | Reaxys |
| CAS:163521-08-2 | ChemIDplus |
| CAS:163521-08-2 | KEGG DRUG |
| Citations |
|---|