EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O3 |
| Net Charge | 0 |
| Average Mass | 294.350 |
| Monoisotopic Mass | 294.12559 |
| SMILES | O=C(/C=C/C=C/c1ccc(O)cc1)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C19H18O3/c20-17(10-7-16-8-13-19(22)14-9-16)4-2-1-3-15-5-11-18(21)12-6-15/h1-6,8-9,11-14,21-22H,7,10H2/b3-1+,4-2+ |
| InChIKey | QIROPQQWKBMABC-ZPUQHVIOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Curcuma kwangsiensis (ncbitaxon:136216) | rhizome (BTO:0001181) | DOI (10.1021/np100392m) | 70% ethanolic extract of rhizomes |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,7-bis(4-hydroxyphenyl)hepta-4E-6E-dien-3-one (CHEBI:70702) has role plant metabolite (CHEBI:76924) |
| 1,7-bis(4-hydroxyphenyl)hepta-4E-6E-dien-3-one (CHEBI:70702) is a diarylheptanoid (CHEBI:78802) |
| 1,7-bis(4-hydroxyphenyl)hepta-4E-6E-dien-3-one (CHEBI:70702) is a enone (CHEBI:51689) |
| 1,7-bis(4-hydroxyphenyl)hepta-4E-6E-dien-3-one (CHEBI:70702) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (4E,6E)-1,7-bis(4-hydroxyphenyl)hepta-4,6-dien-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8783234 | Reaxys |