EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O4 |
| Net Charge | 0 |
| Average Mass | 328.408 |
| Monoisotopic Mass | 328.16746 |
| SMILES | COc1cc(CCC(=O)CCCCc2ccc(O)cc2)ccc1O |
| InChI | InChI=1S/C20H24O4/c1-24-20-14-16(9-13-19(20)23)8-12-17(21)5-3-2-4-15-6-10-18(22)11-7-15/h6-7,9-11,13-14,22-23H,2-5,8,12H2,1H3 |
| InChIKey | QUMBVGAYXWDALH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Curcuma kwangsiensis (ncbitaxon:136216) | rhizome (BTO:0001181) | DOI (10.1021/np100392m) | 70% ethanolic extract of rhizomes |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)-3-heptanone (CHEBI:70701) has role plant metabolite (CHEBI:76924) |
| 1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)-3-heptanone (CHEBI:70701) is a diarylheptanoid (CHEBI:78802) |
| 1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)-3-heptanone (CHEBI:70701) is a guaiacols (CHEBI:134251) |
| 1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)-3-heptanone (CHEBI:70701) is a ketone (CHEBI:17087) |
| IUPAC Name |
|---|
| 1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)heptan-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20090389 | Reaxys |