EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O3 |
| Net Charge | 0 |
| Average Mass | 298.382 |
| Monoisotopic Mass | 298.15689 |
| SMILES | Oc1ccc(CC[C@H](O)CC/C=C/c2ccccc2)cc1O |
| InChI | InChI=1S/C19H22O3/c20-17(9-5-4-8-15-6-2-1-3-7-15)12-10-16-11-13-18(21)19(22)14-16/h1-4,6-8,11,13-14,17,20-22H,5,9-10,12H2/b8-4+/t17-/m1/s1 |
| InChIKey | OELWYQGRQUQQPD-IOMDMTNGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Curcuma kwangsiensis (ncbitaxon:136216) | rhizome (BTO:0001181) | DOI (10.1021/np100392m) | 70% ethanolic extract of rhizomes |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(3R)-1-(3,4-dihydroxyphenyl)-7-phenyl-(6E)-6-hepten-3-ol (CHEBI:70693) has role plant metabolite (CHEBI:76924) |
| (+)-(3R)-1-(3,4-dihydroxyphenyl)-7-phenyl-(6E)-6-hepten-3-ol (CHEBI:70693) is a catechols (CHEBI:33566) |
| (+)-(3R)-1-(3,4-dihydroxyphenyl)-7-phenyl-(6E)-6-hepten-3-ol (CHEBI:70693) is a diarylheptanoid (CHEBI:78802) |
| (+)-(3R)-1-(3,4-dihydroxyphenyl)-7-phenyl-(6E)-6-hepten-3-ol (CHEBI:70693) is a secondary alcohol (CHEBI:35681) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21038414 | Reaxys |