EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O4 |
| Net Charge | 0 |
| Average Mass | 316.397 |
| Monoisotopic Mass | 316.16746 |
| SMILES | Oc1ccc(CCCC[C@@H](O)CCc2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C19H24O4/c20-16(11-7-15-8-12-18(22)19(23)13-15)4-2-1-3-14-5-9-17(21)10-6-14/h5-6,8-10,12-13,16,20-23H,1-4,7,11H2/t16-/m1/s1 |
| InChIKey | SENGGJLGUFGNIH-MRXNPFEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Curcuma kwangsiensis (ncbitaxon:136216) | rhizome (BTO:0001181) | DOI (10.1021/np100392m) | 70% ethanolic extract of rhizomes |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(3R)-1-(3,4-dihydroxyphenyl)-7-(4-hydroxyphenyl)heptan-3-ol (CHEBI:70691) has role plant metabolite (CHEBI:76924) |
| (+)-(3R)-1-(3,4-dihydroxyphenyl)-7-(4-hydroxyphenyl)heptan-3-ol (CHEBI:70691) is a catechols (CHEBI:33566) |
| (+)-(3R)-1-(3,4-dihydroxyphenyl)-7-(4-hydroxyphenyl)heptan-3-ol (CHEBI:70691) is a diarylheptanoid (CHEBI:78802) |
| (+)-(3R)-1-(3,4-dihydroxyphenyl)-7-(4-hydroxyphenyl)heptan-3-ol (CHEBI:70691) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 4-[(3R)-3-hydroxy-7-(4-hydroxyphenyl)heptyl]benzene-1,2-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21038425 | Reaxys |