EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O4 |
| Net Charge | 0 |
| Average Mass | 314.381 |
| Monoisotopic Mass | 314.15181 |
| SMILES | Oc1ccc(/C=C/CC[C@H](O)CCc2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C19H22O4/c20-16(11-7-15-8-12-18(22)19(23)13-15)4-2-1-3-14-5-9-17(21)10-6-14/h1,3,5-6,8-10,12-13,16,20-23H,2,4,7,11H2/b3-1+/t16-/m0/s1 |
| InChIKey | RECNHCLFPNYLCU-VQRJYJFOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Curcuma kwangsiensis (ncbitaxon:136216) | rhizome (BTO:0001181) | DOI (10.1021/np100392m) | 70% ethanolic extract of rhizomes |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-(3S)-1-(3,4-dihydroxyphenyl)-7-(4-hydroxyphenyl)-(6E)-6-hepten-3-ol (CHEBI:70688) has role plant metabolite (CHEBI:76924) |
| (−)-(3S)-1-(3,4-dihydroxyphenyl)-7-(4-hydroxyphenyl)-(6E)-6-hepten-3-ol (CHEBI:70688) is a catechols (CHEBI:33566) |
| (−)-(3S)-1-(3,4-dihydroxyphenyl)-7-(4-hydroxyphenyl)-(6E)-6-hepten-3-ol (CHEBI:70688) is a diarylheptanoid (CHEBI:78802) |
| (−)-(3S)-1-(3,4-dihydroxyphenyl)-7-(4-hydroxyphenyl)-(6E)-6-hepten-3-ol (CHEBI:70688) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 4-[(3S,6E)-3-hydroxy-7-(4-hydroxyphenyl)hept-6-en-1-yl]benzene-1,2-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21038424 | Reaxys |