EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O5 |
| Net Charge | 0 |
| Average Mass | 488.709 |
| Monoisotopic Mass | 488.35017 |
| SMILES | [H][C@]12CC=C3[C@@]4([H])[C@](C(=O)O)(CC[C@@H](C)[C@@]4(C)O)CC[C@@]3(C)[C@]1(C)CC[C@]1([H])[C@]2(C)CC[C@H](O)[C@@]1(C)CO |
| InChI | InChI=1S/C30H48O5/c1-18-9-14-30(24(33)34)16-15-27(4)19(23(30)29(18,6)35)7-8-21-25(2)12-11-22(32)26(3,17-31)20(25)10-13-28(21,27)5/h7,18,20-23,31-32,35H,8-17H2,1-6H3,(H,33,34)/t18-,20-,21-,22+,23-,25+,26+,27-,28-,29-,30+/m1/s1 |
| InChIKey | YLHQFGOOMKJFLP-LTFXOGOQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euscaphis japonica (ncbitaxon:210332) | twig (BTO:0001411) | DOI (10.1021/np1003593) | 95% ethanolic extract of twigs |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rotundic acid (CHEBI:70684) has role metabolite (CHEBI:25212) |
| Rotundic acid (CHEBI:70684) is a triterpenoid (CHEBI:36615) |
| Synonym | Source |
|---|---|
| (3beta,4alpha)-3,19,23-Trihydroxyurs-12-en-28-oic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:20137-37-5 | ChemIDplus |