EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44O4 |
| Net Charge | 0 |
| Average Mass | 468.678 |
| Monoisotopic Mass | 468.32396 |
| SMILES | [H][C@]12C=C[C@]34C[C@]3(CC[C@@]3(C(=O)O)CC[C@@H](C)C(=C)[C@]34[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)[C@H](O)C[C@]21C |
| InChI | InChI=1S/C30H44O4/c1-17-7-11-28(24(33)34)13-14-30-16-29(30,22(28)18(17)2)12-9-21-26(5)15-19(31)23(32)25(3,4)20(26)8-10-27(21,30)6/h9,12,17,19-23,31-32H,2,7-8,10-11,13-16H2,1,3-6H3,(H,33,34)/t17-,19-,20+,21-,22-,23+,26+,27-,28+,29-,30-/m1/s1 |
| InChIKey | BHYFAPCVVRZAQZ-KYHYGKICSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euscaphis japonica (ncbitaxon:210332) | twig (BTO:0001411) | DOI (10.1021/np1003593) | 95% ethanolic extract of twigs |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Euscaphic acid F (CHEBI:70680) has role metabolite (CHEBI:25212) |
| Euscaphic acid F (CHEBI:70680) is a triterpenoid (CHEBI:36615) |
| Synonym | Source |
|---|---|
| 2alpha,3beta-dihydroxy-13alpha,27-cyclours-11,29-dien-28-oic acid | ChEBI |