EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O5 |
| Net Charge | 0 |
| Average Mass | 486.693 |
| Monoisotopic Mass | 486.33452 |
| SMILES | [H][C@]12C=C[C@]34C[C@]3(CC[C@@]3(C(=O)O)CC[C@@H](C)[C@@](C)(O)[C@]34[H])[C@]1(C)CC[C@]1([H])[C@]2(C)CC[C@H](O)[C@@]1(C)CO |
| InChI | InChI=1S/C30H46O5/c1-18-6-12-28(23(33)34)14-15-30-16-29(30,22(28)27(18,5)35)13-8-20-24(2)10-9-21(32)25(3,17-31)19(24)7-11-26(20,30)4/h8,13,18-22,31-32,35H,6-7,9-12,14-17H2,1-5H3,(H,33,34)/t18-,19-,20-,21+,22-,24+,25+,26-,27-,28+,29-,30-/m1/s1 |
| InChIKey | PDPWDXDUMOJUCT-UWQOUJQISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euscaphis japonica (ncbitaxon:210332) | twig (BTO:0001411) | DOI (10.1021/np1003593) | 95% ethanolic extract of twigs |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Euscaphic acid B (CHEBI:70676) has role metabolite (CHEBI:25212) |
| Euscaphic acid B (CHEBI:70676) is a triterpenoid (CHEBI:36615) |
| Synonym | Source |
|---|---|
| 3beta,19alpha,23-trihydroxy-13alpha,27-cyclours-11-en-28-oic acid | ChEBI |