EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O4 |
| Net Charge | 0 |
| Average Mass | 270.284 |
| Monoisotopic Mass | 270.08921 |
| SMILES | Cc1c(O)cc(O)c2c1O[C@H](c1ccccc1)CC2=O |
| InChI | InChI=1S/C16H14O4/c1-9-11(17)7-12(18)15-13(19)8-14(20-16(9)15)10-5-3-2-4-6-10/h2-7,14,17-18H,8H2,1H3/t14-/m0/s1 |
| InChIKey | QSRIZZQWNHKERT-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cleistocalyx operculatus (IPNI:82151-3) | flower bud (BTO:0000470) | DOI (10.1021/np1002753) | Combined methanolic extract of dried buds |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-8-methylpinocembrin (CHEBI:70663) has functional parent pinocembrin (CHEBI:28157) |
| (2S)-8-methylpinocembrin (CHEBI:70663) has role plant metabolite (CHEBI:76924) |
| (2S)-8-methylpinocembrin (CHEBI:70663) is a (2S)-flavan-4-one (CHEBI:140377) |
| (2S)-8-methylpinocembrin (CHEBI:70663) is a dihydroxyflavanone (CHEBI:38749) |
| IUPAC Name |
|---|
| (2S)-5,7-dihydroxy-8-methyl-2-phenyl-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| (2S)-5,7-dihydroxy-8-methylflavanone | ChEBI |
| (S)-2,3-Dihydro-5,7-dihydroxy-8-methyl-2-phenyl-4-benzopyrone | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:88409 | Reaxys |
| CAS:55743-21-0 | ChemIDplus |
| Citations |
|---|