EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O4 |
| Net Charge | 0 |
| Average Mass | 284.311 |
| Monoisotopic Mass | 284.10486 |
| SMILES | COc1cc(O)c(C)c2c1C(=O)C[C@@H](c1ccccc1)O2 |
| InChI | InChI=1S/C17H16O4/c1-10-12(18)8-15(20-2)16-13(19)9-14(21-17(10)16)11-6-4-3-5-7-11/h3-8,14,18H,9H2,1-2H3/t14-/m0/s1 |
| InChIKey | VQRIOVIKJMGUNI-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cleistocalyx operculatus (IPNI:82151-3) | flower bud (BTO:0000470) | DOI (10.1021/np1002753) | Combined methanolic extract of dried buds |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-7-hydroxy-5-methoxy-8-methylflavanone (CHEBI:70662) has functional parent (2S)-flavanone (CHEBI:15606) |
| (2S)-7-hydroxy-5-methoxy-8-methylflavanone (CHEBI:70662) has role plant metabolite (CHEBI:76924) |
| (2S)-7-hydroxy-5-methoxy-8-methylflavanone (CHEBI:70662) is a monohydroxyflavanone (CHEBI:38748) |
| (2S)-7-hydroxy-5-methoxy-8-methylflavanone (CHEBI:70662) is a monomethoxyflavanone (CHEBI:38738) |
| IUPAC Name |
|---|
| (2S)-7-hydroxy-5-methoxy-8-methyl-2-phenyl-2,3-dihydrochromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21040399 | Reaxys |
| Citations |
|---|