EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18O4 |
| Net Charge | 0 |
| Average Mass | 298.338 |
| Monoisotopic Mass | 298.12051 |
| SMILES | COc1c(C)c(O)c2c(c1C)O[C@H](c1ccccc1)CC2=O |
| InChI | InChI=1S/C18H18O4/c1-10-16(20)15-13(19)9-14(12-7-5-4-6-8-12)22-18(15)11(2)17(10)21-3/h4-8,14,20H,9H2,1-3H3/t14-/m0/s1 |
| InChIKey | KZNAGLGLKRUIPD-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cleistocalyx operculatus (IPNI:82151-3) | flower bud (BTO:0000470) | DOI (10.1021/np1002753) | Combined methanolic extract of dried buds |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-5-hydroxy-7-methoxy-6,8-dimethylflavanone (CHEBI:70657) has functional parent (2S)-flavanone (CHEBI:15606) |
| (2S)-5-hydroxy-7-methoxy-6,8-dimethylflavanone (CHEBI:70657) has role plant metabolite (CHEBI:76924) |
| (2S)-5-hydroxy-7-methoxy-6,8-dimethylflavanone (CHEBI:70657) is a monohydroxyflavanone (CHEBI:38748) |
| (2S)-5-hydroxy-7-methoxy-6,8-dimethylflavanone (CHEBI:70657) is a monomethoxyflavanone (CHEBI:38738) |
| IUPAC Name |
|---|
| (2S)-5-hydroxy-7-methoxy-6,8-dimethyl-2-phenyl-2,3-dihydro-4H-chromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:90681 | Reaxys |
| Citations |
|---|