EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18O5 |
| Net Charge | 0 |
| Average Mass | 314.337 |
| Monoisotopic Mass | 314.11542 |
| SMILES | COc1c(C)c(O)c(C)c(O)c1C(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C18H18O5/c1-10-16(21)11(2)18(23-3)15(17(10)22)14(20)9-6-12-4-7-13(19)8-5-12/h4-9,19,21-22H,1-3H3/b9-6+ |
| InChIKey | HTDSMOBGCNRBHQ-RMKNXTFCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cleistocalyx operculatus (IPNI:82151-3) | flower bud (BTO:0000470) | DOI (10.1021/np1002753) | Combined methanolic extract of dried buds |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. |
| Application: | EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-4,2',4'-trihydroxy-6'-methoxy-3',5'-dimethylchalcone (CHEBI:70655) has functional parent trans-chalcone (CHEBI:48965) |
| (E)-4,2',4'-trihydroxy-6'-methoxy-3',5'-dimethylchalcone (CHEBI:70655) has role EC 3.2.1.18 (exo-α-sialidase) inhibitor (CHEBI:52425) |
| (E)-4,2',4'-trihydroxy-6'-methoxy-3',5'-dimethylchalcone (CHEBI:70655) has role plant metabolite (CHEBI:76924) |
| (E)-4,2',4'-trihydroxy-6'-methoxy-3',5'-dimethylchalcone (CHEBI:70655) is a chalcones (CHEBI:23086) |
| (E)-4,2',4'-trihydroxy-6'-methoxy-3',5'-dimethylchalcone (CHEBI:70655) is a monomethoxybenzene (CHEBI:25235) |
| (E)-4,2',4'-trihydroxy-6'-methoxy-3',5'-dimethylchalcone (CHEBI:70655) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (2E)-1-(2,4-dihydroxy-6-methoxy-3,5-dimethylphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21040404 | Reaxys |
| Citations |
|---|