EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H13NO5 |
| Net Charge | 0 |
| Average Mass | 335.315 |
| Monoisotopic Mass | 335.07937 |
| SMILES | COc1cc2ccnc3c2c(c1OC)-c1cc2c(cc1C3=O)OCO2 |
| InChI | InChI=1S/C19H13NO5/c1-22-14-5-9-3-4-20-17-15(9)16(19(14)23-2)10-6-12-13(25-8-24-12)7-11(10)18(17)21/h3-7H,8H2,1-2H3 |
| InChIKey | NFDVJYPMLVMXRR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Annona glabra (ncbitaxon:301703) | stem wood (BTO:0001469) | DOI (10.1021/np100247r) | Ethanolic extract of stemwood |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxonantenine (CHEBI:70651) has functional parent aporphine (CHEBI:35643) |
| oxonantenine (CHEBI:70651) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| oxonantenine (CHEBI:70651) has role plant metabolite (CHEBI:76924) |
| oxonantenine (CHEBI:70651) is a alkaloid antibiotic (CHEBI:86322) |
| oxonantenine (CHEBI:70651) is a aromatic ether (CHEBI:35618) |
| oxonantenine (CHEBI:70651) is a organic heteropentacyclic compound (CHEBI:38164) |
| oxonantenine (CHEBI:70651) is a oxacycle (CHEBI:38104) |
| oxonantenine (CHEBI:70651) is a oxoaporphine alkaloid (CHEBI:132998) |
| IUPAC Name |
|---|
| 1,2-dimethoxy-7H-benzo[de][1,3]benzodioxolo[5,6-g]quinolin-7-one |
| Synonym | Source |
|---|---|
| 1,2-dimethoxy-4,5,6,6a-tetradehydro-9,10-(methylenedioxy)noraprophin-7-one | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00025995 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1088888 | Reaxys |
| CAS:15358-38-0 | ChemIDplus |
| Citations |
|---|