EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H9NO3 |
| Net Charge | 0 |
| Average Mass | 275.263 |
| Monoisotopic Mass | 275.05824 |
| SMILES | O=C1c2ccccc2-c2c3c(cc4ccnc1c24)OCO3 |
| InChI | InChI=1S/C17H9NO3/c19-16-11-4-2-1-3-10(11)14-13-9(5-6-18-15(13)16)7-12-17(14)21-8-20-12/h1-7H,8H2 |
| InChIKey | MUMCCPUVOAUBAN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Annona glabra (ncbitaxon:301703) | stem wood (BTO:0001469) | DOI (10.1021/np100247r) | Ethanolic extract of stemwood |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| liriodenine (CHEBI:70649) has functional parent aporphine (CHEBI:35643) |
| liriodenine (CHEBI:70649) has role antifungal agent (CHEBI:35718) |
| liriodenine (CHEBI:70649) has role antimicrobial agent (CHEBI:33281) |
| liriodenine (CHEBI:70649) has role antineoplastic agent (CHEBI:35610) |
| liriodenine (CHEBI:70649) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| liriodenine (CHEBI:70649) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| liriodenine (CHEBI:70649) has role metabolite (CHEBI:25212) |
| liriodenine (CHEBI:70649) is a alkaloid antibiotic (CHEBI:86322) |
| liriodenine (CHEBI:70649) is a cyclic ketone (CHEBI:3992) |
| liriodenine (CHEBI:70649) is a organic heteropentacyclic compound (CHEBI:38164) |
| liriodenine (CHEBI:70649) is a oxacycle (CHEBI:38104) |
| liriodenine (CHEBI:70649) is a oxoaporphine alkaloid (CHEBI:132998) |
| IUPAC Name |
|---|
| 8H-[1,3]benzodioxolo[6,5,4-de]benzo[g]quinolin-8-one |
| Synonyms | Source |
|---|---|
| Liriodenine | KEGG COMPOUND |
| Micheline B | ChemIDplus |
| Noraporphin-7-one, 4,5,6,6a-tetradehydro-1,2-(methylenedioxy)- | ChemIDplus |
| Oxoushinsunine | ChemIDplus |
| Oxoushinsunine | KEGG COMPOUND |
| Spermatheridine | ChemIDplus |
| Citations |
|---|