EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12O2 |
| Net Charge | 0 |
| Average Mass | 200.237 |
| Monoisotopic Mass | 200.08373 |
| SMILES | COc1cc(O)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C13H12O2/c1-15-13-8-11(7-12(14)9-13)10-5-3-2-4-6-10/h2-9,14H,1H3 |
| InChIKey | MFGGGJCBWVBPEO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhaphiolepis indica var. tashiroi (ncbitaxon:36624) | root (BTO:0001188) | DOI (10.1021/np100200s) | Cold methanolic extract of dried roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-5-methoxybiphenyl (CHEBI:70633) has role metabolite (CHEBI:25212) |
| 3-hydroxy-5-methoxybiphenyl (CHEBI:70633) is a biphenyls (CHEBI:22888) |
| Synonym | Source |
|---|---|
| 3-methoxy-5-phenylphenol | ChEBI |