EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12O3 |
| Net Charge | 0 |
| Average Mass | 216.236 |
| Monoisotopic Mass | 216.07864 |
| SMILES | COc1cc(O)cc(-c2ccccc2O)c1 |
| InChI | InChI=1S/C13H12O3/c1-16-11-7-9(6-10(14)8-11)12-4-2-3-5-13(12)15/h2-8,14-15H,1H3 |
| InChIKey | XBBDTINCHJPZGW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhaphiolepis indica var. tashiroi (ncbitaxon:36624) | root (BTO:0001188) | DOI (10.1021/np100200s) | Cold methanolic extract of dried roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2',3-dihydroxy-5-methoxybiphenyl (CHEBI:70632) has role metabolite (CHEBI:25212) |
| 2',3-dihydroxy-5-methoxybiphenyl (CHEBI:70632) is a hydroxybiphenyls (CHEBI:24681) |
| Synonym | Source |
|---|---|
| 3-(2-hydroxyphenyl)-5-methoxyphenol | ChEBI |