EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32O14 |
| Net Charge | 0 |
| Average Mass | 592.550 |
| Monoisotopic Mass | 592.17921 |
| SMILES | [H][C@@]1(O[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]2c2c(O)cc(O)c3c(=O)cc(-c4ccc(OC)cc4)oc23)O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C28H32O14/c1-10-20(33)22(35)24(37)28(39-10)42-27-23(36)21(34)17(9-29)41-26(27)19-14(31)7-13(30)18-15(32)8-16(40-25(18)19)11-3-5-12(38-2)6-4-11/h3-8,10,17,20-24,26-31,33-37H,9H2,1-2H3/t10-,17+,20-,21+,22+,23-,24+,26-,27+,28-/m0/s1 |
| InChIKey | AOXGLIJSZLOQNZ-WBXLRLGPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternanthera maritima (IPNI:59233-1) | - | DOI (10.1021/np100004v) | |
| Alternanthera tenella (ncbitaxon:326744) | - | DOI (10.1021/np100004v) | |
| Fortunella japonica (ncbitaxon:76966) | - | DOI (10.1021/np100004v) | |
| Fortunella margarita (ncbitaxon:85437) | - | DOI (10.1021/np100004v) | |
| Piper ossanum (ncbitaxon:405338) | leaf (BTO:0000713) | DOI (10.1021/np100004v) | Aqueous extract of dried and ground leaves |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acacetin-8-C-neohesperidoside (CHEBI:70626) has functional parent 5,7-dihydroxy-4'-methoxyflavone (CHEBI:15335) |
| acacetin-8-C-neohesperidoside (CHEBI:70626) has role plant metabolite (CHEBI:76924) |
| acacetin-8-C-neohesperidoside (CHEBI:70626) is a dihydroxyflavone (CHEBI:38686) |
| acacetin-8-C-neohesperidoside (CHEBI:70626) is a disaccharide derivative (CHEBI:63353) |
| acacetin-8-C-neohesperidoside (CHEBI:70626) is a flavone C-glycoside (CHEBI:83280) |
| acacetin-8-C-neohesperidoside (CHEBI:70626) is a monomethoxyflavone (CHEBI:25401) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-2-O-(6-deoxy-α-L-mannopyranosyl)-1-[5,7-dihydroxy-2-(4-methoxyphenyl)-4-oxo-4H-1-benzopyran-8-yl]-D-glucitol |
| Synonyms | Source |
|---|---|
| 2''-O-α-rhamnosyl-4'-O-methylvitexin | ChEBI |
| Acacetin-8-C-α-rhamnosyl-(1→2)-β-glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6886008 | Reaxys |