EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O4 |
| Net Charge | 0 |
| Average Mass | 470.694 |
| Monoisotopic Mass | 470.33961 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4(C)CC(=O)O[C@@H](C(=C)C)[C@@]43[H])[C@]1(C)CC[C@@]([H])(C(=C)C)[C@]2(C)CCC(=O)O |
| InChI | InChI=1S/C30H46O4/c1-18(2)20-11-14-30(8)22(28(20,6)13-12-23(31)32)10-9-21-25-26(19(3)4)34-24(33)17-27(25,5)15-16-29(21,30)7/h20-22,25-26H,1,3,9-17H2,2,4-8H3,(H,31,32)/t20-,21+,22+,25-,26-,27-,28-,29+,30+/m0/s1 |
| InChIKey | GLULXLZRZYHBBI-IYUQAJJVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lippia mexicana (IPNI:981940-1) | |||
| flower (BTO:0000469) | PubMed (20942442) | Dried and ground leaves, flowers, and stems were extracted with Me2CO and then with MeOH | |
| stem (BTO:0001300) | PubMed (20942442) | Dried and ground leaves, flowers, and stems were extracted with Me2CO and then with MeOH | |
| leaf (BTO:0000713) | PubMed (20942442) | Dried and ground leaves, flowers, and stems were extracted with Me2CO and then with MeOH |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lippiolidolic acid (CHEBI:70623) has role metabolite (CHEBI:25212) |
| lippiolidolic acid (CHEBI:70623) is a diterpene lactone (CHEBI:49193) |
| Synonym | Source |
|---|---|
| 3,4:19,21-di-secolupa-4(23),20(29)-diene-21,19-lacton-3-oic acid | ChEBI |
| Citations |
|---|