EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O4 |
| Net Charge | 0 |
| Average Mass | 470.694 |
| Monoisotopic Mass | 470.33961 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4(C)CC(=O)O[C@@H](C(=C)C)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@]3(O)CC[C@]21CO3 |
| InChI | InChI=1S/C30H46O4/c1-18(2)24-23-19-8-9-21-28(7,27(19,6)13-12-26(23,5)16-22(31)34-24)11-10-20-25(3,4)30(32)15-14-29(20,21)17-33-30/h19-21,23-24,32H,1,8-17H2,2-7H3/t19-,20+,21+,23+,24+,26+,27-,28-,29-,30-/m1/s1 |
| InChIKey | XVOHBMBYVJHVEX-PVXVMCPWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lippia mexicana (IPNI:981940-1) | |||
| leaf (BTO:0000713) | PubMed (20942442) | Dried and ground leaves, flowers, and stems were extracted with Me2CO and then with MeOH | |
| stem (BTO:0001300) | PubMed (20942442) | Dried and ground leaves, flowers, and stems were extracted with Me2CO and then with MeOH | |
| flower (BTO:0000469) | PubMed (20942442) | Dried and ground leaves, flowers, and stems were extracted with Me2CO and then with MeOH |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lippiolide (CHEBI:70622) has role metabolite (CHEBI:25212) |
| lippiolide (CHEBI:70622) is a organic heterotricyclic compound (CHEBI:26979) |
| lippiolide (CHEBI:70622) is a organooxygen compound (CHEBI:36963) |
| Synonym | Source |
|---|---|
| 3beta,25-epoxy-3alpha-hydroxy-19,21-seco-lup-20(29)-en-21,19-lactone | ChEBI |
| Citations |
|---|