EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H6Br4O2 |
| Net Charge | 0 |
| Average Mass | 501.794 |
| Monoisotopic Mass | 497.71013 |
| SMILES | Oc1c(Br)cc(Br)cc1-c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C12H6Br4O2/c13-5-1-7(11(17)9(15)3-5)8-2-6(14)4-10(16)12(8)18/h1-4,17-18H |
| InChIKey | TXODBIOSWNNKJM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudoalteromonas (ncbitaxon:53249) | - | PubMed (20973551) | The culture was extracted with an equal volume of EtOAc,species isolated from surface of nudibranch Strain: CMMED 290 |
| Pseudoalteromonas phenolica (ncbitaxon:161398) | - | PubMed (20973551) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bromophene (CHEBI:70620) has role metabolite (CHEBI:25212) |
| bromophene (CHEBI:70620) is a biphenyls (CHEBI:22888) |
| bromophene (CHEBI:70620) is a organobromine compound (CHEBI:37141) |
| Synonym | Source |
|---|---|
| 3,3',5,5'-Tetrabromo-2,2'-biphenyldiol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:21987-62-2 | ChemIDplus |
| Citations |
|---|