EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H4Br5NO |
| Net Charge | 0 |
| Average Mass | 553.668 |
| Monoisotopic Mass | 548.62097 |
| SMILES | Oc1c(Br)cc(Br)cc1-c1nc(Br)c(Br)c1Br |
| InChI | InChI=1S/C10H4Br5NO/c11-3-1-4(9(17)5(12)2-3)8-6(13)7(14)10(15)16-8/h1-2,16-17H |
| InChIKey | LXMNWKJHYOZUQL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chromobacterium (ncbitaxon:306190) | - | PubMed (20973551) | |
| Pseudoalteromonas (ncbitaxon:53249) | - | PubMed (20973551) | The culture was extracted with an equal volume of EtOAc,species isolated from surface of nudibranch Strain: CMMED 290 |
| Pseudoalteromonas bromoutilis (ncbitaxon:53246) | - | PubMed (20973551) | |
| Pseudoalteromonas luteoviolacea (ncbitaxon:43657) | - | PubMed (20973551) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentabromopseudilin (CHEBI:70619) has role metabolite (CHEBI:25212) |
| pentabromopseudilin (CHEBI:70619) is a pyrroles (CHEBI:26455) |
| Synonym | Source |
|---|---|
| 2,4-Dibromo-6-(3,4,5-tribromo-1H-pyrrol-2-yl)phenol | ChEBI |
| Citations |
|---|