EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H7Br3O2 |
| Net Charge | 0 |
| Average Mass | 422.898 |
| Monoisotopic Mass | 419.79962 |
| SMILES | Oc1ccc(Br)cc1-c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C12H7Br3O2/c13-6-1-2-11(16)8(3-6)9-4-7(14)5-10(15)12(9)17/h1-5,16-17H |
| InChIKey | KLKDPRUXCGOLFU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudoalteromonas (ncbitaxon:53249) | - | PubMed (20973551) | The culture was extracted with an equal volume of EtOAc,species isolated from surface of nudibranch Strain: CMMED 290 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,4',6-Tribromo-2,2'-biphenol (CHEBI:70618) has role metabolite (CHEBI:25212) |
| 4,4',6-Tribromo-2,2'-biphenol (CHEBI:70618) is a biphenyls (CHEBI:22888) |
| 4,4',6-Tribromo-2,2'-biphenol (CHEBI:70618) is a organobromine compound (CHEBI:37141) |
| Citations |
|---|