EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H3Br4NO |
| Net Charge | 0 |
| Average Mass | 472.756 |
| Monoisotopic Mass | 468.69481 |
| SMILES | Brc1cc(Br)c2oc3c(Br)c(Br)nc3c2c1 |
| InChI | InChI=1S/C10H3Br4NO/c11-3-1-4-7-9(6(13)10(14)15-7)16-8(4)5(12)2-3/h1-2,15H |
| InChIKey | ICCCQEGUOIWMQK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudoalteromonas (ncbitaxon:53249) | - | PubMed (20973551) | The culture was extracted with an equal volume of EtOAc,species isolated from surface of nudibranch Strain: CMMED 290 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,5,7-Tetrabromobenzofuro[3,2-b]pyrrole (CHEBI:70617) has role metabolite (CHEBI:25212) |
| 2,3,5,7-Tetrabromobenzofuro[3,2-b]pyrrole (CHEBI:70617) is a benzofurans (CHEBI:35259) |
| Citations |
|---|