EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24O8 |
| Net Charge | 0 |
| Average Mass | 356.371 |
| Monoisotopic Mass | 356.14712 |
| SMILES | [H][C@@]1(Oc2c(OC)cc(/C=C/C)cc2OC)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H24O8/c1-4-5-9-6-10(22-2)16(11(7-9)23-3)25-17-15(21)14(20)13(19)12(8-18)24-17/h4-7,12-15,17-21H,8H2,1-3H3/b5-4+/t12-,13-,14+,15-,17+/m1/s1 |
| InChIKey | ZDLGCAQIENQSSF-QIQYSRIJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ferula gumosa (ncbitaxon:371349) | root (BTO:0001188) | PubMed (20961138) | The plant powder was extracted with MeOH |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acantrifoside E (CHEBI:70615) has role metabolite (CHEBI:25212) |
| acantrifoside E (CHEBI:70615) is a glycoside (CHEBI:24400) |
| Citations |
|---|