EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28O5 |
| Net Charge | 0 |
| Average Mass | 396.483 |
| Monoisotopic Mass | 396.19367 |
| SMILES | [H][C@]12C(=O)C=C(C)[C@@H](COc3ccc4ccc(=O)oc4c3)[C@@]1(C)CC[C@H](O)C2(C)C |
| InChI | InChI=1S/C24H28O5/c1-14-11-18(25)22-23(2,3)20(26)9-10-24(22,4)17(14)13-28-16-7-5-15-6-8-21(27)29-19(15)12-16/h5-8,11-12,17,20,22,26H,9-10,13H2,1-4H3/t17-,20+,22-,24-/m1/s1 |
| InChIKey | HIQLOIOGTRDMIW-LWSJSWBQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ferula gumosa (ncbitaxon:371349) | root (BTO:0001188) | PubMed (20961138) | The plant powder was extracted with MeOH |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| conferol, (rel)- (CHEBI:70614) has role metabolite (CHEBI:25212) |
| conferol, (rel)- (CHEBI:70614) is a coumarins (CHEBI:23403) |
| Synonym | Source |
|---|---|
| rel-7-[[(1R,4aS,6S,8aR)-6-hydroxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methoxy]chromen-2-one | ChEBI |
| Citations |
|---|