EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30O4 |
| Net Charge | 0 |
| Average Mass | 382.500 |
| Monoisotopic Mass | 382.21441 |
| SMILES | [H][C@@]12CCC(=C)[C@H](COc3ccc4ccc(=O)oc4c3)[C@@]1(C)CC[C@@H](O)C2(C)C |
| InChI | InChI=1S/C24H30O4/c1-15-5-9-20-23(2,3)21(25)11-12-24(20,4)18(15)14-27-17-8-6-16-7-10-22(26)28-19(16)13-17/h6-8,10,13,18,20-21,25H,1,5,9,11-12,14H2,2-4H3/t18-,20-,21+,24+/m0/s1 |
| InChIKey | FCWYNTDTQPCVPG-IKQBDLNTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ferula gumosa (ncbitaxon:371349) | root (BTO:0001188) | PubMed (20961138) | The plant powder was extracted with MeOH |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferilin (CHEBI:70611) has role metabolite (CHEBI:25212) |
| ferilin (CHEBI:70611) is a coumarins (CHEBI:23403) |
| Synonym | Source |
|---|---|
| 7-[[(1S,4aR,6R,8aS)-6-hydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy]chromen-2-one | ChEBI |
| Citations |
|---|