EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H48O14 |
| Net Charge | 0 |
| Average Mass | 692.755 |
| Monoisotopic Mass | 692.30441 |
| SMILES | [H][C@@]1(O[C@@H]2CC(=C)[C@@H](COc3ccc4ccc(=O)oc4c3)[C@]3(C)CC[C@@H](O)C(C)(C)[C@@]23[H])O[C@H](CO[C@@H]2OC[C@](O)(CO)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C35H48O14/c1-17-11-22(48-31-28(41)27(40)26(39)23(49-31)14-45-32-30(42)35(43,15-36)16-46-32)29-33(2,3)24(37)9-10-34(29,4)20(17)13-44-19-7-5-18-6-8-25(38)47-21(18)12-19/h5-8,12,20,22-24,26-32,36-37,39-43H,1,9-11,13-16H2,2-4H3/t20-,22-,23-,24-,26-,27+,28-,29-,30+,31-,32-,34+,35-/m1/s1 |
| InChIKey | NYTFNIAPHAVHOA-ORYSZERHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ferula gumosa (ncbitaxon:371349) | root (BTO:0001188) | PubMed (20961138) | The plant powder was extracted with MeOH |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gumoside A (CHEBI:70606) has role metabolite (CHEBI:25212) |
| Gumoside A (CHEBI:70606) is a coumarins (CHEBI:23403) |
| Citations |
|---|