EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O6 |
| Net Charge | 0 |
| Average Mass | 370.401 |
| Monoisotopic Mass | 370.14164 |
| SMILES | C/C=C(/C)C(=O)OCc1c2c(c(OC)c3cccc(C)c13)OC(=O)[C@]2(C)O |
| InChI | InChI=1S/C21H22O6/c1-6-11(2)19(22)26-10-14-15-12(3)8-7-9-13(15)17(25-5)18-16(14)21(4,24)20(23)27-18/h6-9,24H,10H2,1-5H3/b11-6-/t21-/m1/s1 |
| InChIKey | PHJXJLUAXVXKCQ-JLXOPUERSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Parasenecio deltophyllus (ncbitaxon:186962) | aerial part (BTO:0001658) | PubMed (20968296) | The air-dried aerial parts were powdered and extracted with petroleum ether-Et2O-MeOH |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14-angeloyloxy-11alpha-hydroxy-Omethyl-1,2,3,4-tetrahydrocacalolide (CHEBI:70603) has role metabolite (CHEBI:25212) |
| 14-angeloyloxy-11alpha-hydroxy-Omethyl-1,2,3,4-tetrahydrocacalolide (CHEBI:70603) is a naphthofuran (CHEBI:39270) |
| Synonym | Source |
|---|---|
| [(3R)-3-hydroxy-9-methoxy-3,5-dimethyl-2-oxobenzo[f][1]benzofuran-4-yl]methyl(Z)-2-methylbut-2-enoate | ChEBI |
| Citations |
|---|