EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O6 |
| Net Charge | 0 |
| Average Mass | 370.401 |
| Monoisotopic Mass | 370.14164 |
| SMILES | [H][C@@]12O[C@]1([H])C(=O)c1c(c(COC(=O)/C(C)=C\C)c3c(C)coc3c1OC)[C@H]2C |
| InChI | InChI=1S/C21H22O6/c1-6-9(2)21(23)26-8-12-13-10(3)7-25-19(13)18(24-5)15-14(12)11(4)17-20(27-17)16(15)22/h6-7,11,17,20H,8H2,1-5H3/b9-6-/t11-,17+,20-/m1/s1 |
| InChIKey | FBZSDKQMXBAROQ-HHTLWVCYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Parasenecio deltophyllus (ncbitaxon:186962) | aerial part (BTO:0001658) | PubMed (20968296) | The air-dried aerial parts were powdered and extracted with petroleum ether-Et2O-MeOH |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14-angeloyloxy-2alpha,3alpha-epoxy-1-oxo-O-methylcacalol (CHEBI:70602) has role metabolite (CHEBI:25212) |
| 14-angeloyloxy-2alpha,3alpha-epoxy-1-oxo-O-methylcacalol (CHEBI:70602) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| [(1aS,8R,8aS)-3-Methoxy-6,8-dimethyl-2-oxo-1a,2,8,8a-tetrahydrooxireno[6,7]naphtho[2,3-b]furan-7-yl]methyl (2Z)-2-methyl-2-butenoate | ChEBI |
| Citations |
|---|