EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O5 |
| Net Charge | 0 |
| Average Mass | 344.407 |
| Monoisotopic Mass | 344.16237 |
| SMILES | C/C=C(/C)C(=O)OCc1c(C(C)=O)c(O)c(OC)c2c1[C@@H](C)CC=C2 |
| InChI | InChI=1S/C20H24O5/c1-6-11(2)20(23)25-10-15-16-12(3)8-7-9-14(16)19(24-5)18(22)17(15)13(4)21/h6-7,9,12,22H,8,10H2,1-5H3/b11-6-/t12-/m0/s1 |
| InChIKey | QCIYZQPUFWEBMV-DSDFTUOUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Parasenecio deltophyllus (ncbitaxon:186962) | aerial part (BTO:0001658) | PubMed (20968296) | The air-dried aerial parts were powdered and extracted with petroleum ether-Et2O-MeOH |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14-angeloyloxydeltonorcacalol (CHEBI:70599) has role metabolite (CHEBI:25212) |
| 14-angeloyloxydeltonorcacalol (CHEBI:70599) is a naphthols (CHEBI:25392) |
| Synonym | Source |
|---|---|
| [(8S)-2-acetyl-3-hydroxy-4-methoxy-8-methyl-7,8-dihydronaphthalen-1-yl]methyl (Z)-2-methylbut-2-enoate | ChEBI |
| Citations |
|---|