EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H57NO2 |
| Net Charge | 0 |
| Average Mass | 451.780 |
| Monoisotopic Mass | 451.43893 |
| SMILES | CCCCCCCC(C)CCCCCCCC/C=C\CCCCCC[C@@H]1OC[C@H](N)[C@@H]1O |
| InChI | InChI=1S/C29H57NO2/c1-3-4-5-16-19-22-26(2)23-20-17-14-12-10-8-6-7-9-11-13-15-18-21-24-28-29(31)27(30)25-32-28/h7,9,26-29,31H,3-6,8,10-25,30H2,1-2H3/b9-7-/t26?,27-,28-,29-/m0/s1 |
| InChIKey | OUKNGSYCVUDFOT-VUDYHDPXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penares (ncbitaxon:77185) | - | PubMed (20949915) | The sponge was extracted with MeOH and CHCl3/MeOH and compound is mixture of three Positional isomer |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penasin E (CHEBI:70598) has role metabolite (CHEBI:25212) |
| Penasin E (CHEBI:70598) is a monosaccharide (CHEBI:35381) |
| Synonym | Source |
|---|---|
| (2S,3S,4S)-4-Amino-2-[(7Z)-17-methyl-7-tetracosen-1-yl]tetrahydro-3-furanol | ChEBI |
| Citations |
|---|