EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H57NO2 |
| Net Charge | 0 |
| Average Mass | 463.791 |
| Monoisotopic Mass | 463.43893 |
| SMILES | CCCCCCCCCCCCCCCC/C=C\CC/C=C\CCCC[C@@H]1OC[C@H](N)[C@@H]1O |
| InChI | InChI=1S/C30H57NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-29-30(32)28(31)27-33-29/h17-18,21-22,28-30,32H,2-16,19-20,23-27,31H2,1H3/b18-17-,22-21-/t28-,29-,30-/m0/s1 |
| InChIKey | ALQUBUWDXLROPS-NKLHEEPMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penares (ncbitaxon:77185) | - | PubMed (20949915) | The frozen sponge was homogenized and extracted with MeOH and CHCl3/MeOH(1:1) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penasin A (CHEBI:70594) has role metabolite (CHEBI:25212) |
| Penasin A (CHEBI:70594) is a monosaccharide (CHEBI:35381) |
| Synonym | Source |
|---|---|
| (2S,3S,4S)-4-amino-2-[(5Z,9Z)-hexacosa-5,9-dienyl]oxolan-3-ol | ChEBI |
| Citations |
|---|