EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12N4O2 |
| Net Charge | 0 |
| Average Mass | 268.276 |
| Monoisotopic Mass | 268.09603 |
| SMILES | Cc1cc(=O)n2nc(CC(=O)c3ccccc3)nc2n1 |
| InChI | InChI=1S/C14H12N4O2/c1-9-7-13(20)18-14(15-9)16-12(17-18)8-11(19)10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H,15,16,17) |
| InChIKey | OFYCCAJFLXMBKD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (20836523) | Strain: Merv8102 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Essramycin (CHEBI:70592) has role metabolite (CHEBI:25212) |
| Essramycin (CHEBI:70592) is a triazolopyrimidines (CHEBI:48435) |
| Synonym | Source |
|---|---|
| 5-methyl-2-phenacyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one | ChEBI |
| Citations |
|---|