EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O5 |
| Net Charge | 0 |
| Average Mass | 370.445 |
| Monoisotopic Mass | 370.17802 |
| SMILES | COc1ccc([C@@H]2c3cc(OC)c(OC)cc3C(=O)[C@@H](C)[C@H]2C)cc1OC |
| InChI | InChI=1S/C22H26O5/c1-12-13(2)22(23)16-11-20(27-6)19(26-5)10-15(16)21(12)14-7-8-17(24-3)18(9-14)25-4/h7-13,21H,1-6H3/t12-,13+,21-/m1/s1 |
| InChIKey | UCHGPGXURWMCBZ-RRMDADRESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Holostylis reniformis (ncbitaxon:304172) | - | PubMed (20961092) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-8'-epi-aristoligone (CHEBI:70591) has role metabolite (CHEBI:25212) |
| (-)-8'-epi-aristoligone (CHEBI:70591) is a lignan (CHEBI:25036) |
| Synonym | Source |
|---|---|
| (2S,3S,4R)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2,3-dimethyl-3,4-dihydro-2H-naphthalen-1-one | ChEBI |
| Citations |
|---|