EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H53N7O12 |
| Net Charge | 0 |
| Average Mass | 811.890 |
| Monoisotopic Mass | 811.37522 |
| SMILES | CCCCCC1CC(=O)N[C@@H](CO)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](CCCNC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)O1 |
| InChI | InChI=1S/C39H53N7O12/c1-2-3-5-11-26-20-32(49)42-31(22-47)37(55)45-28(18-23-9-6-4-7-10-23)36(54)44-29(19-24-13-15-25(48)16-14-24)35(53)43-27(12-8-17-41-39(40)57)34(52)46-30(21-33(50)51)38(56)58-26/h4,6-7,9-10,13-16,26-31,47-48H,2-3,5,8,11-12,17-22H2,1H3,(H,42,49)(H,43,53)(H,44,54)(H,45,55)(H,46,52)(H,50,51)(H3,40,41,57)/t26?,27-,28+,29+,30+,31+/m1/s1 |
| InChIKey | ONZIPRUJMWNLDH-REVKYEQOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scytonema hofmanni (ncbitaxon:34078) | - | PubMed (21058727) | Lyophilized cell material of freshwater cyanobacterium was extracted with MeOH-CH2Cl2 (1:1) Strain: UTEX 1834 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Scytonemide B (CHEBI:70590) has role metabolite (CHEBI:25212) |
| Scytonemide B (CHEBI:70590) is a cyclodepsipeptide (CHEBI:35213) |
| Citations |
|---|