EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11NO2S |
| Net Charge | 0 |
| Average Mass | 221.281 |
| Monoisotopic Mass | 221.05105 |
| SMILES | Cc1sc(-c2ccccc2O)nc1CO |
| InChI | InChI=1S/C11H11NO2S/c1-7-9(6-13)12-11(15-7)8-4-2-3-5-10(8)14/h2-5,13-14H,6H2,1H3 |
| InChIKey | LIOYHUUBTDVXBY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces species CP32 (ncbitaxon:926355) | - | PubMed (21028889) | Organism was cultivated from Conus pulicarius |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pulicatin C (CHEBI:70586) has role metabolite (CHEBI:25212) |
| Pulicatin C (CHEBI:70586) is a 1,3-thiazoles (CHEBI:38418) |
| Synonym | Source |
|---|---|
| 2-[4-(Hydroxymethyl)-5-methyl-1,3-thiazol-2-yl]phenol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 27022793 | ChemSpider |
| Citations |
|---|