EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13NO2S |
| Net Charge | 0 |
| Average Mass | 223.297 |
| Monoisotopic Mass | 223.06670 |
| SMILES | C[C@@H]1SC(c2ccccc2O)=N[C@@H]1CO |
| InChI | InChI=1S/C11H13NO2S/c1-7-9(6-13)12-11(15-7)8-4-2-3-5-10(8)14/h2-5,7,9,13-14H,6H2,1H3/t7-,9+/m0/s1 |
| InChIKey | ZVWPMYHMXUXIMC-IONNQARKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (21028889) | organism was cultivated from the hepatopancreas of the cone snail Conus tribblei Strain: CT8 |
| Streptomyces species CP32 (ncbitaxon:926355) | - | PubMed (21028889) | Organism was cultivated from Conus pulicarius |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pulicatin A (CHEBI:70584) has role metabolite (CHEBI:25212) |
| Pulicatin A (CHEBI:70584) is a phenols (CHEBI:33853) |
| Synonym | Source |
|---|---|
| 2-[(4R,5S)-4-(hydroxymethyl)-5-methyl-4,5-dihydrothiazol-2-yl]phenol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 26390381 | ChemSpider |
| Citations |
|---|