EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10N2O2S |
| Net Charge | 0 |
| Average Mass | 222.269 |
| Monoisotopic Mass | 222.04630 |
| SMILES | NC(=O)C1CSC(c2ccccc2O)=N1 |
| InChI | InChI=1S/C10H10N2O2S/c11-9(14)7-5-15-10(12-7)6-3-1-2-4-8(6)13/h1-4,7,13H,5H2,(H2,11,14) |
| InChIKey | CMXJVCRUSKHTHR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces species CP32 (ncbitaxon:926355) | - | PubMed (21028889) | Organism was cultivated from Conus pulicarius |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pulicatin G (CHEBI:70581) has role metabolite (CHEBI:25212) |
| pulicatin G (CHEBI:70581) is a 1,3-thiazoles (CHEBI:38418) |
| pulicatin G (CHEBI:70581) is a aromatic amide (CHEBI:62733) |
| Synonym | Source |
|---|---|
| 2-(2-hydroxyphenyl)-4,5-dihydrothiazole-4-carboxamide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 26391091 | ChemSpider |
| Citations |
|---|